C17H31N3O — CID 102995261
N'-ethyl-N'-[2-[(2-methoxyethylamino)methyl]phenyl]-N,N-dimethylpropane-1,3-diamine (PubChem CID 102995261) has the molecular formula C17H31N3O and a molecular weight of 293.46 g/mol. Its IUPAC name is N'-ethyl-N'-[2-[(2-methoxyethylamino)methyl]phenyl]-N,N-dimethylpropane-1,3-diamine.
| Compound Name | N'-ethyl-N'-[2-[(2-methoxyethylamino)methyl]phenyl]-N,N-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 102995261 |
| Molecular Formula | C17H31N3O |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | N'-ethyl-N'-[2-[(2-methoxyethylamino)methyl]phenyl]-N,N-dimethylpropane-1,3-diamine |
| SMILES | CCN(CCCN(C)C)c1ccccc1CNCCOC |
| InChI | InChI=1S/C17H31N3O/c1-5-20(13-8-12-19(2)3)17-10-7-6-9-16(17)15-18-11-14-21-4/h6-7,9-10,18H,5,8,11-15H2,1-4H3 |
| InChIKey | WOKCSMUPVVBAHA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|