C21H21BrClNOS2 — CID 10299617
2-[(17-bromo-3,13-dithiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7,9,11,15,17-octaen-4-yl)methoxy]-N,N-dimethylethanamine;hydrochloride (PubChem CID 10299617) has the molecular formula C21H21BrClNOS2 and a molecular weight of 482.90 g/mol. Its IUPAC name is 2-[(17-bromo-3,13-dithiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7,9,11,15,17-octaen-4-yl)methoxy]-N,N-dimethylethanamine;hydrochloride.
| Compound Name | 2-[(17-bromo-3,13-dithiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7,9,11,15,17-octaen-4-yl)methoxy]-N,N-dimethylethanamine;hydrochloride |
|---|---|
| PubChem CID | 10299617 |
| Molecular Formula | C21H21BrClNOS2 |
| Molecular Weight | 482.90 g/mol |
| Exact Mass | 480.99 |
| IUPAC Name | 2-[(17-bromo-3,13-dithiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7,9,11,15,17-octaen-4-yl)methoxy]-N,N-dimethylethanamine;hydrochloride |
| SMILES | CN(C)CCOCc1cc2c(s1)-c1cc(Br)ccc1Sc1ccccc1-2.Cl |
| InChI | InChI=1S/C21H20BrNOS2.ClH/c1-23(2)9-10-24-13-15-12-17-16-5-3-4-6-19(16)26-20-8-7-14(22)11-18(20)21(17)25-15;/h3-8,11-12H,9-10,13H2,1-2H3;1H |
| InChIKey | BIIWZXUFHNODJC-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.90 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|