C21H17Cl2F3N4O2 — CID 10299770
2-[5-chloro-2-[[2,2-difluoro-2-(1-oxidopyridin-1-ium-2-yl)ethyl]amino]-3-fluoro-4-pyridinyl]-N-[(3-chlorophenyl)methyl]acetamide (PubChem CID 10299770) has the molecular formula C21H17Cl2F3N4O2 and a molecular weight of 485.29 g/mol. Its IUPAC name is 2-[5-chloro-2-[[2,2-difluoro-2-(1-oxidopyridin-1-ium-2-yl)ethyl]amino]-3-fluoro-4-pyridinyl]-N-[(3-chlorophenyl)methyl]acetamide.
| Compound Name | 2-[5-chloro-2-[[2,2-difluoro-2-(1-oxidopyridin-1-ium-2-yl)ethyl]amino]-3-fluoro-4-pyridinyl]-N-[(3-chlorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 10299770 |
| Molecular Formula | C21H17Cl2F3N4O2 |
| Molecular Weight | 485.29 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | 2-[5-chloro-2-[[2,2-difluoro-2-(1-oxidopyridin-1-ium-2-yl)ethyl]amino]-3-fluoro-4-pyridinyl]-N-[(3-chlorophenyl)methyl]acetamide |
| SMILES | O=C(Cc1c(Cl)cnc(NCC(F)(F)c2cccc[n+]2[O-])c1F)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H17Cl2F3N4O2/c22-14-5-3-4-13(8-14)10-27-18(31)9-15-16(23)11-28-20(19(15)24)29-12-21(25,26)17-6-1-2-7-30(17)32/h1-8,11H,9-10,12H2,(H,27,31)(H,28,29) |
| InChIKey | RXWKZQCUXZYOFF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 80.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.29 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|