C17H39N3O — CID 102998403
4-[3-(diethylamino)propyl-ethylamino]-2-methyl-2-(propylamino)butan-1-ol (PubChem CID 102998403) has the molecular formula C17H39N3O and a molecular weight of 301.52 g/mol. Its IUPAC name is 4-[3-(diethylamino)propyl-ethylamino]-2-methyl-2-(propylamino)butan-1-ol.
| Compound Name | 4-[3-(diethylamino)propyl-ethylamino]-2-methyl-2-(propylamino)butan-1-ol |
|---|---|
| PubChem CID | 102998403 |
| Molecular Formula | C17H39N3O |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.31 |
| IUPAC Name | 4-[3-(diethylamino)propyl-ethylamino]-2-methyl-2-(propylamino)butan-1-ol |
| SMILES | CCCNC(C)(CO)CCN(CC)CCCN(CC)CC |
| InChI | InChI=1S/C17H39N3O/c1-6-12-18-17(5,16-21)11-15-20(9-4)14-10-13-19(7-2)8-3/h18,21H,6-16H2,1-5H3 |
| InChIKey | GCZIGTUWIRSVJJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |