C23H19F4N5O3 — CID 10299995
[6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methyl (NE)-N-(dimethylaminomethylidene)carbamate (PubChem CID 10299995) has the molecular formula C23H19F4N5O3 and a molecular weight of 489.43 g/mol. Its IUPAC name is [6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methyl (NE)-N-(dimethylaminomethylidene)carbamate.
| Compound Name | [6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methyl (NE)-N-(dimethylaminomethylidene)carbamate |
|---|---|
| PubChem CID | 10299995 |
| Molecular Formula | C23H19F4N5O3 |
| Molecular Weight | 489.43 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | [6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)-3-pyridinyl]methyl (NE)-N-(dimethylaminomethylidene)carbamate |
| SMILES | CN(C)/C=N/C(=O)OCc1ccc(N(C(N)=O)c2c(F)cccc2F)nc1-c1ccc(F)cc1F |
| InChI | InChI=1S/C23H19F4N5O3/c1-31(2)12-29-23(34)35-11-13-6-9-19(30-20(13)15-8-7-14(24)10-18(15)27)32(22(28)33)21-16(25)4-3-5-17(21)26/h3-10,12H,11H2,1-2H3,(H2,28,33)/b29-12+ |
| InChIKey | OWNHSSJEGFNHPR-XKJRVUDJSA-N |
| XLogP | 4.75 |
| TPSA | 101.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|