About 4-N-(2,2-dimethylcyclopropyl)quinoline-4,7-diamine
4-N-(2,2-dimethylcyclopropyl)quinoline-4,7-diamine (PubChem CID 103000945) has the molecular formula C14H17N3
and a molecular weight of 227.31 g/mol. Its IUPAC name is 4-N-(2,2-dimethylcyclopropyl)quinoline-4,7-diamine.
Molecular Properties
| Compound Name | 4-N-(2,2-dimethylcyclopropyl)quinoline-4,7-diamine |
| PubChem CID | 103000945 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 4-N-(2,2-dimethylcyclopropyl)quinoline-4,7-diamine |
| SMILES | CC1(C)CC1Nc1ccnc2cc(N)ccc12 |
| InChI | InChI=1S/C14H17N3/c1-14(2)8-13(14)17-11-5-6-16-12-7-9(15)3-4-10(11)12/h3-7,13H,8,15H2,1-2H3,(H,16,17) |
| InChIKey | VINLJEPYXSFBNI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-N-(2,2-dimethylcyclopropyl)quinoline-4,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(2,2-dimethylcyclopropyl)quinoline-4,7-diamine?
The IUPAC name of 4-N-(2,2-dimethylcyclopropyl)quinoline-4,7-diamine (CID 103000945) is 4-N-(2,2-dimethylcyclopropyl)quinoline-4,7-diamine.
What is the SMILES notation for 4-N-(2,2-dimethylcyclopropyl)quinoline-4,7-diamine?
The canonical SMILES for 4-N-(2,2-dimethylcyclopropyl)quinoline-4,7-diamine is CC1(C)CC1Nc1ccnc2cc(N)ccc12.
What is the InChIKey of 4-N-(2,2-dimethylcyclopropyl)quinoline-4,7-diamine?
The InChIKey is VINLJEPYXSFBNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3/c1-14(2)8-13(14)17-11-5-6-16-12-7-9(15)3-4-10(11)12/h3-7,13H,8,15H2,1-2H3,(H,16,17).
What are the key properties of 4-N-(2,2-dimethylcyclopropyl)quinoline-4,7-diamine?
4-N-(2,2-dimethylcyclopropyl)quinoline-4,7-diamine has a molecular weight of 227.31 g/mol, XLogP of 3.03, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(2,2-dimethylcyclopropyl)quinoline-4,7-diamine is sourced from PubChem (CID 103000945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).