C14H23N3 — CID 103001567
2,2-dicyclopropyl-N-[2-(1-methylpyrazol-4-yl)ethyl]ethanamine (PubChem CID 103001567) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 2,2-dicyclopropyl-N-[2-(1-methylpyrazol-4-yl)ethyl]ethanamine.
| Compound Name | 2,2-dicyclopropyl-N-[2-(1-methylpyrazol-4-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 103001567 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 2,2-dicyclopropyl-N-[2-(1-methylpyrazol-4-yl)ethyl]ethanamine |
| SMILES | Cn1cc(CCNCC(C2CC2)C2CC2)cn1 |
| InChI | InChI=1S/C14H23N3/c1-17-10-11(8-16-17)6-7-15-9-14(12-2-3-12)13-4-5-13/h8,10,12-15H,2-7,9H2,1H3 |
| InChIKey | MOKFKMWNDFCPRQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|