About 2-(2-chlorophenyl)-1-(4-chlorophenyl)-N'-(2,4-dichlorophenyl)imidazole-4-carbohydrazide
2-(2-chlorophenyl)-1-(4-chlorophenyl)-N'-(2,4-dichlorophenyl)imidazole-4-carbohydrazide (PubChem CID 10300161) has the molecular formula C22H14Cl4N4O
and a molecular weight of 492.19 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1-(4-chlorophenyl)-N'-(2,4-dichlorophenyl)imidazole-4-carbohydrazide.
Molecular Properties
| Compound Name | 2-(2-chlorophenyl)-1-(4-chlorophenyl)-N'-(2,4-dichlorophenyl)imidazole-4-carbohydrazide |
| PubChem CID | 10300161 |
| Molecular Formula | C22H14Cl4N4O |
| Molecular Weight | 492.19 g/mol |
| Exact Mass | 489.99 |
| IUPAC Name | 2-(2-chlorophenyl)-1-(4-chlorophenyl)-N'-(2,4-dichlorophenyl)imidazole-4-carbohydrazide |
| SMILES | O=C(NNc1ccc(Cl)cc1Cl)c1cn(-c2ccc(Cl)cc2)c(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C22H14Cl4N4O/c23-13-5-8-15(9-6-13)30-12-20(27-21(30)16-3-1-2-4-17(16)25)22(31)29-28-19-10-7-14(24)11-18(19)26/h1-12,28H,(H,29,31) |
| InChIKey | JUNAMSBYRYGGKP-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.19 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-chlorophenyl)-1-(4-chlorophenyl)-N'-(2,4-dichlorophenyl)imidazole-4-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chlorophenyl)-1-(4-chlorophenyl)-N'-(2,4-dichlorophenyl)imidazole-4-carbohydrazide?
The IUPAC name of 2-(2-chlorophenyl)-1-(4-chlorophenyl)-N'-(2,4-dichlorophenyl)imidazole-4-carbohydrazide (CID 10300161) is 2-(2-chlorophenyl)-1-(4-chlorophenyl)-N'-(2,4-dichlorophenyl)imidazole-4-carbohydrazide.
What is the SMILES notation for 2-(2-chlorophenyl)-1-(4-chlorophenyl)-N'-(2,4-dichlorophenyl)imidazole-4-carbohydrazide?
The canonical SMILES for 2-(2-chlorophenyl)-1-(4-chlorophenyl)-N'-(2,4-dichlorophenyl)imidazole-4-carbohydrazide is O=C(NNc1ccc(Cl)cc1Cl)c1cn(-c2ccc(Cl)cc2)c(-c2ccccc2Cl)n1.
What is the InChIKey of 2-(2-chlorophenyl)-1-(4-chlorophenyl)-N'-(2,4-dichlorophenyl)imidazole-4-carbohydrazide?
The InChIKey is JUNAMSBYRYGGKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14Cl4N4O/c23-13-5-8-15(9-6-13)30-12-20(27-21(30)16-3-1-2-4-17(16)25)22(31)29-28-19-10-7-14(24)11-18(19)26/h1-12,28H,(H,29,31).
What are the key properties of 2-(2-chlorophenyl)-1-(4-chlorophenyl)-N'-(2,4-dichlorophenyl)imidazole-4-carbohydrazide?
2-(2-chlorophenyl)-1-(4-chlorophenyl)-N'-(2,4-dichlorophenyl)imidazole-4-carbohydrazide has a molecular weight of 492.19 g/mol, XLogP of 6.91, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chlorophenyl)-1-(4-chlorophenyl)-N'-(2,4-dichlorophenyl)imidazole-4-carbohydrazide is sourced from PubChem (CID 10300161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).