C21H17FN2O7S2 — CID 10300174
5-[5-(3-fluoro-5-nitrophenyl)pent-4-ynyl]-5-(4-methoxyphenyl)sulfonyl-1,3-thiazolidine-2,4-dione (PubChem CID 10300174) has the molecular formula C21H17FN2O7S2 and a molecular weight of 492.51 g/mol. Its IUPAC name is 5-[5-(3-fluoro-5-nitrophenyl)pent-4-ynyl]-5-(4-methoxyphenyl)sulfonyl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[5-(3-fluoro-5-nitrophenyl)pent-4-ynyl]-5-(4-methoxyphenyl)sulfonyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10300174 |
| Molecular Formula | C21H17FN2O7S2 |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.05 |
| IUPAC Name | 5-[5-(3-fluoro-5-nitrophenyl)pent-4-ynyl]-5-(4-methoxyphenyl)sulfonyl-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(S(=O)(=O)C2(CCCC#Cc3cc(F)cc([N+](=O)[O-])c3)SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C21H17FN2O7S2/c1-31-17-6-8-18(9-7-17)33(29,30)21(19(25)23-20(26)32-21)10-4-2-3-5-14-11-15(22)13-16(12-14)24(27)28/h6-9,11-13H,2,4,10H2,1H3,(H,23,25,26) |
| InChIKey | RKUWMBJNEYFNIR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|