C13H22N4S — CID 103002660
2-[cyclopentyl-[2-(1-methylpyrazol-4-yl)ethyl]amino]ethanethioamide (PubChem CID 103002660) has the molecular formula C13H22N4S and a molecular weight of 266.41 g/mol. Its IUPAC name is 2-[cyclopentyl-[2-(1-methylpyrazol-4-yl)ethyl]amino]ethanethioamide.
| Compound Name | 2-[cyclopentyl-[2-(1-methylpyrazol-4-yl)ethyl]amino]ethanethioamide |
|---|---|
| PubChem CID | 103002660 |
| Molecular Formula | C13H22N4S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 2-[cyclopentyl-[2-(1-methylpyrazol-4-yl)ethyl]amino]ethanethioamide |
| SMILES | Cn1cc(CCN(CC(N)=S)C2CCCC2)cn1 |
| InChI | InChI=1S/C13H22N4S/c1-16-9-11(8-15-16)6-7-17(10-13(14)18)12-4-2-3-5-12/h8-9,12H,2-7,10H2,1H3,(H2,14,18) |
| InChIKey | XZEUFQYZXRKYPH-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|