C15H19BrN2O2 — CID 103003729
4-[2-[4-(bromomethyl)-2-ethoxyphenoxy]ethyl]-1-methylpyrazole (PubChem CID 103003729) has the molecular formula C15H19BrN2O2 and a molecular weight of 339.23 g/mol. Its IUPAC name is 4-[2-[4-(bromomethyl)-2-ethoxyphenoxy]ethyl]-1-methylpyrazole.
| Compound Name | 4-[2-[4-(bromomethyl)-2-ethoxyphenoxy]ethyl]-1-methylpyrazole |
|---|---|
| PubChem CID | 103003729 |
| Molecular Formula | C15H19BrN2O2 |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 4-[2-[4-(bromomethyl)-2-ethoxyphenoxy]ethyl]-1-methylpyrazole |
| SMILES | CCOc1cc(CBr)ccc1OCCc1cnn(C)c1 |
| InChI | InChI=1S/C15H19BrN2O2/c1-3-19-15-8-12(9-16)4-5-14(15)20-7-6-13-10-17-18(2)11-13/h4-5,8,10-11H,3,6-7,9H2,1-2H3 |
| InChIKey | OSOXLAPQCHJFAC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|