C12H14BFN2O3 — CID 103003921
[2-fluoro-4-[2-(2-methylpyrazol-3-yl)ethoxy]phenyl]boronic acid (PubChem CID 103003921) has the molecular formula C12H14BFN2O3 and a molecular weight of 264.06 g/mol. Its IUPAC name is [2-fluoro-4-[2-(2-methylpyrazol-3-yl)ethoxy]phenyl]boronic acid.
| Compound Name | [2-fluoro-4-[2-(2-methylpyrazol-3-yl)ethoxy]phenyl]boronic acid |
|---|---|
| PubChem CID | 103003921 |
| Molecular Formula | C12H14BFN2O3 |
| Molecular Weight | 264.06 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | [2-fluoro-4-[2-(2-methylpyrazol-3-yl)ethoxy]phenyl]boronic acid |
| SMILES | Cn1nccc1CCOc1ccc(B(O)O)c(F)c1 |
| InChI | InChI=1S/C12H14BFN2O3/c1-16-9(4-6-15-16)5-7-19-10-2-3-11(13(17)18)12(14)8-10/h2-4,6,8,17-18H,5,7H2,1H3 |
| InChIKey | IRWZZORCGYKERR-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.06 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|