C27H27N7O3 — CID 10300451
5-[(Z)-[4-(3-ethynylanilino)-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-ylidene]methyl]-4-methyl-N-(2-morpholin-4-ylethyl)-1H-pyrrole-2-carboxamide (PubChem CID 10300451) has the molecular formula C27H27N7O3 and a molecular weight of 497.56 g/mol. Its IUPAC name is 5-[(Z)-[4-(3-ethynylanilino)-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-ylidene]methyl]-4-methyl-N-(2-morpholin-4-ylethyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 5-[(Z)-[4-(3-ethynylanilino)-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-ylidene]methyl]-4-methyl-N-(2-morpholin-4-ylethyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 10300451 |
| Molecular Formula | C27H27N7O3 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | 5-[(Z)-[4-(3-ethynylanilino)-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-ylidene]methyl]-4-methyl-N-(2-morpholin-4-ylethyl)-1H-pyrrole-2-carboxamide |
| SMILES | C#Cc1cccc(Nc2ncnc3c2/C(=C/c2[nH]c(C(=O)NCCN4CCOCC4)cc2C)C(=O)N3)c1 |
| InChI | InChI=1S/C27H27N7O3/c1-3-18-5-4-6-19(14-18)31-24-23-20(26(35)33-25(23)30-16-29-24)15-21-17(2)13-22(32-21)27(36)28-7-8-34-9-11-37-12-10-34/h1,4-6,13-16,32H,7-12H2,2H3,(H,28,36)(H2,29,30,31,33,35)/b20-15- |
| InChIKey | ZJXFDKWJAGZFLT-HKWRFOASSA-N |
| XLogP | 2.39 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|