C15H19ClN4O — CID 103005653
2-chloro-N-[2-(2-methylpyrazol-3-yl)ethyl]-6-propylpyridine-4-carboxamide (PubChem CID 103005653) has the molecular formula C15H19ClN4O and a molecular weight of 306.80 g/mol. Its IUPAC name is 2-chloro-N-[2-(2-methylpyrazol-3-yl)ethyl]-6-propylpyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[2-(2-methylpyrazol-3-yl)ethyl]-6-propylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 103005653 |
| Molecular Formula | C15H19ClN4O |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-chloro-N-[2-(2-methylpyrazol-3-yl)ethyl]-6-propylpyridine-4-carboxamide |
| SMILES | CCCc1cc(C(=O)NCCc2ccnn2C)cc(Cl)n1 |
| InChI | InChI=1S/C15H19ClN4O/c1-3-4-12-9-11(10-14(16)19-12)15(21)17-7-5-13-6-8-18-20(13)2/h6,8-10H,3-5,7H2,1-2H3,(H,17,21) |
| InChIKey | JRRDEOHNFNYPIS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|