C9H15N3O — CID 103006388
3-[2-(1-methylpyrazol-4-yl)ethyl]azetidin-3-ol (PubChem CID 103006388) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 3-[2-(1-methylpyrazol-4-yl)ethyl]azetidin-3-ol.
| Compound Name | 3-[2-(1-methylpyrazol-4-yl)ethyl]azetidin-3-ol |
|---|---|
| PubChem CID | 103006388 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 3-[2-(1-methylpyrazol-4-yl)ethyl]azetidin-3-ol |
| SMILES | Cn1cc(CCC2(O)CNC2)cn1 |
| InChI | InChI=1S/C9H15N3O/c1-12-5-8(4-11-12)2-3-9(13)6-10-7-9/h4-5,10,13H,2-3,6-7H2,1H3 |
| InChIKey | GRJIBSAIUMPGQE-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |