C11H21N5O — CID 103007279
N'-hydroxy-3-[2-(2-methylpyrazol-3-yl)ethylamino]pentanimidamide (PubChem CID 103007279) has the molecular formula C11H21N5O and a molecular weight of 239.32 g/mol. Its IUPAC name is N'-hydroxy-3-[2-(2-methylpyrazol-3-yl)ethylamino]pentanimidamide.
| Compound Name | N'-hydroxy-3-[2-(2-methylpyrazol-3-yl)ethylamino]pentanimidamide |
|---|---|
| PubChem CID | 103007279 |
| Molecular Formula | C11H21N5O |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | N'-hydroxy-3-[2-(2-methylpyrazol-3-yl)ethylamino]pentanimidamide |
| SMILES | CCC(CC(N)=NO)NCCc1ccnn1C |
| InChI | InChI=1S/C11H21N5O/c1-3-9(8-11(12)15-17)13-6-4-10-5-7-14-16(10)2/h5,7,9,13,17H,3-4,6,8H2,1-2H3,(H2,12,15) |
| InChIKey | JRGISWJJAMMZOD-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|