C15H20ClN3 — CID 103009058
1-(3-chlorophenyl)-N-methyl-4-(2-methylpyrazol-3-yl)butan-2-amine (PubChem CID 103009058) has the molecular formula C15H20ClN3 and a molecular weight of 277.80 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-methyl-4-(2-methylpyrazol-3-yl)butan-2-amine.
| Compound Name | 1-(3-chlorophenyl)-N-methyl-4-(2-methylpyrazol-3-yl)butan-2-amine |
|---|---|
| PubChem CID | 103009058 |
| Molecular Formula | C15H20ClN3 |
| Molecular Weight | 277.80 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 1-(3-chlorophenyl)-N-methyl-4-(2-methylpyrazol-3-yl)butan-2-amine |
| SMILES | CNC(CCc1ccnn1C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H20ClN3/c1-17-14(6-7-15-8-9-18-19(15)2)11-12-4-3-5-13(16)10-12/h3-5,8-10,14,17H,6-7,11H2,1-2H3 |
| InChIKey | WZQRPRPGXFGMCC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.80 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |