C27H39NO6S — CID 10300909
(4S,7R,8S,9S,11E,13Z,16S)-4,8-dihydroxy-16-[(E)-1-[2-(hydroxymethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-5,5,7,9,13-pentamethyl-1-oxacyclohexadeca-11,13-diene-2,6-dione (PubChem CID 10300909) has the molecular formula C27H39NO6S and a molecular weight of 505.68 g/mol. Its IUPAC name is (4S,7R,8S,9S,11E,13Z,16S)-4,8-dihydroxy-16-[(E)-1-[2-(hydroxymethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-5,5,7,9,13-pentamethyl-1-oxacyclohexadeca-11,13-diene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,11E,13Z,16S)-4,8-dihydroxy-16-[(E)-1-[2-(hydroxymethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-5,5,7,9,13-pentamethyl-1-oxacyclohexadeca-11,13-diene-2,6-dione |
|---|---|
| PubChem CID | 10300909 |
| Molecular Formula | C27H39NO6S |
| Molecular Weight | 505.68 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | (4S,7R,8S,9S,11E,13Z,16S)-4,8-dihydroxy-16-[(E)-1-[2-(hydroxymethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-5,5,7,9,13-pentamethyl-1-oxacyclohexadeca-11,13-diene-2,6-dione |
| SMILES | CC1=C\C[C@@H](/C(C)=C/c2csc(CO)n2)OC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)C\C=C\1 |
| InChI | InChI=1S/C27H39NO6S/c1-16-8-7-9-17(2)25(32)19(4)26(33)27(5,6)22(30)13-24(31)34-21(11-10-16)18(3)12-20-15-35-23(14-29)28-20/h7-8,10,12,15,17,19,21-22,25,29-30,32H,9,11,13-14H2,1-6H3/b8-7+,16-10+,18-12+/t17-,19+,21-,22-,25-/m0/s1 |
| InChIKey | SWNDWZDPIFXSQW-DBGAOSHGSA-N |
| XLogP | 4.23 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.68 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |