C12H14BrN3O — CID 103009202
4-bromo-3-[2-(2-methylpyrazol-3-yl)ethoxy]aniline (PubChem CID 103009202) has the molecular formula C12H14BrN3O and a molecular weight of 296.17 g/mol. Its IUPAC name is 4-bromo-3-[2-(2-methylpyrazol-3-yl)ethoxy]aniline.
| Compound Name | 4-bromo-3-[2-(2-methylpyrazol-3-yl)ethoxy]aniline |
|---|---|
| PubChem CID | 103009202 |
| Molecular Formula | C12H14BrN3O |
| Molecular Weight | 296.17 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 4-bromo-3-[2-(2-methylpyrazol-3-yl)ethoxy]aniline |
| SMILES | Cn1nccc1CCOc1cc(N)ccc1Br |
| InChI | InChI=1S/C12H14BrN3O/c1-16-10(4-6-15-16)5-7-17-12-8-9(14)2-3-11(12)13/h2-4,6,8H,5,7,14H2,1H3 |
| InChIKey | QEIQNCCFFZECQC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.17 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|