C27H41NO6S — CID 10301007
(1S,3S,7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[1-methyl-2-(2-methyl-1,3-thiazol-4-yl)cyclopropyl]-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 10301007) has the molecular formula C27H41NO6S and a molecular weight of 507.69 g/mol. Its IUPAC name is (1S,3S,7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[1-methyl-2-(2-methyl-1,3-thiazol-4-yl)cyclopropyl]-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3S,7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[1-methyl-2-(2-methyl-1,3-thiazol-4-yl)cyclopropyl]-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 10301007 |
| Molecular Formula | C27H41NO6S |
| Molecular Weight | 507.69 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | (1S,3S,7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[1-methyl-2-(2-methyl-1,3-thiazol-4-yl)cyclopropyl]-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | Cc1nc(C2CC2(C)[C@@H]2C[C@@H]3O[C@@H]3CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O2)cs1 |
| InChI | InChI=1S/C27H41NO6S/c1-14-8-7-9-19-20(33-19)10-22(27(6)12-17(27)18-13-35-16(3)28-18)34-23(30)11-21(29)26(4,5)25(32)15(2)24(14)31/h13-15,17,19-22,24,29,31H,7-12H2,1-6H3/t14-,15+,17?,19+,20-,21-,22-,24-,27?/m0/s1 |
| InChIKey | OPOOCQFHGVOCHR-PTTDTPFPSA-N |
| XLogP | 4.18 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.69 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|