C12H14BrN3O4 — CID 103010344
2-[1-[(2-bromo-5-nitrophenoxy)methyl]cyclopropyl]-N'-hydroxyethanimidamide (PubChem CID 103010344) has the molecular formula C12H14BrN3O4 and a molecular weight of 344.17 g/mol. Its IUPAC name is 2-[1-[(2-bromo-5-nitrophenoxy)methyl]cyclopropyl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[1-[(2-bromo-5-nitrophenoxy)methyl]cyclopropyl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 103010344 |
| Molecular Formula | C12H14BrN3O4 |
| Molecular Weight | 344.17 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 2-[1-[(2-bromo-5-nitrophenoxy)methyl]cyclopropyl]-N'-hydroxyethanimidamide |
| SMILES | N/C(CC1(COc2cc([N+](=O)[O-])ccc2Br)CC1)=N/O |
| InChI | InChI=1S/C12H14BrN3O4/c13-9-2-1-8(16(18)19)5-10(9)20-7-12(3-4-12)6-11(14)15-17/h1-2,5,17H,3-4,6-7H2,(H2,14,15) |
| InChIKey | GGKAGZFDJZITMA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 110.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.17 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|