C29H35NO5S — CID 10301106
5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)sulfanyl]-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide (PubChem CID 10301106) has the molecular formula C29H35NO5S and a molecular weight of 509.67 g/mol. Its IUPAC name is 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)sulfanyl]-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide.
| Compound Name | 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)sulfanyl]-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 10301106 |
| Molecular Formula | C29H35NO5S |
| Molecular Weight | 509.67 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)sulfanyl]-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide |
| SMILES | COc1cc(OC)c(NC(=O)c2ccc(Sc3cc4c(cc3C)C(C)(C)CCC4(C)C)o2)c(OC)c1 |
| InChI | InChI=1S/C29H35NO5S/c1-17-13-19-20(29(4,5)12-11-28(19,2)3)16-24(17)36-25-10-9-21(35-25)27(31)30-26-22(33-7)14-18(32-6)15-23(26)34-8/h9-10,13-16H,11-12H2,1-8H3,(H,30,31) |
| InChIKey | JZSSPTHVFWEXEW-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.67 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |