C10H16F3N3 — CID 103011400
6,6,6-trifluoro-1-(1-methylpyrazol-4-yl)hexan-3-amine (PubChem CID 103011400) has the molecular formula C10H16F3N3 and a molecular weight of 235.25 g/mol. Its IUPAC name is 6,6,6-trifluoro-1-(1-methylpyrazol-4-yl)hexan-3-amine.
| Compound Name | 6,6,6-trifluoro-1-(1-methylpyrazol-4-yl)hexan-3-amine |
|---|---|
| PubChem CID | 103011400 |
| Molecular Formula | C10H16F3N3 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 6,6,6-trifluoro-1-(1-methylpyrazol-4-yl)hexan-3-amine |
| SMILES | Cn1cc(CCC(N)CCC(F)(F)F)cn1 |
| InChI | InChI=1S/C10H16F3N3/c1-16-7-8(6-15-16)2-3-9(14)4-5-10(11,12)13/h6-7,9H,2-5,14H2,1H3 |
| InChIKey | IZCROYPDCBVMPM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |