C7H11N7 — CID 103012189
1-[2-(2-methylpyrazol-3-yl)ethyl]tetrazol-5-amine (PubChem CID 103012189) has the molecular formula C7H11N7 and a molecular weight of 193.21 g/mol. Its IUPAC name is 1-[2-(2-methylpyrazol-3-yl)ethyl]tetrazol-5-amine.
| Compound Name | 1-[2-(2-methylpyrazol-3-yl)ethyl]tetrazol-5-amine |
|---|---|
| PubChem CID | 103012189 |
| Molecular Formula | C7H11N7 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 1-[2-(2-methylpyrazol-3-yl)ethyl]tetrazol-5-amine |
| SMILES | Cn1nccc1CCn1nnnc1N |
| InChI | InChI=1S/C7H11N7/c1-13-6(2-4-9-13)3-5-14-7(8)10-11-12-14/h2,4H,3,5H2,1H3,(H2,8,10,12) |
| InChIKey | VMBZSZVAECCILW-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |