C12H17BrN2O5S — CID 103013091
2-[(2-bromo-5-nitrophenoxy)methyl]-3-methylbutane-1-sulfonamide (PubChem CID 103013091) has the molecular formula C12H17BrN2O5S and a molecular weight of 381.25 g/mol. Its IUPAC name is 2-[(2-bromo-5-nitrophenoxy)methyl]-3-methylbutane-1-sulfonamide.
| Compound Name | 2-[(2-bromo-5-nitrophenoxy)methyl]-3-methylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 103013091 |
| Molecular Formula | C12H17BrN2O5S |
| Molecular Weight | 381.25 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | 2-[(2-bromo-5-nitrophenoxy)methyl]-3-methylbutane-1-sulfonamide |
| SMILES | CC(C)C(COc1cc([N+](=O)[O-])ccc1Br)CS(N)(=O)=O |
| InChI | InChI=1S/C12H17BrN2O5S/c1-8(2)9(7-21(14,18)19)6-20-12-5-10(15(16)17)3-4-11(12)13/h3-5,8-9H,6-7H2,1-2H3,(H2,14,18,19) |
| InChIKey | RCXTZOIAZYJOPQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|