C32H36FN3O2 — CID 10301312
(2-fluorophenyl) N-[2-methyl-8-(2-methyl-4,5-diphenylimidazol-1-yl)octan-3-yl]carbamate (PubChem CID 10301312) has the molecular formula C32H36FN3O2 and a molecular weight of 513.66 g/mol. Its IUPAC name is (2-fluorophenyl) N-[2-methyl-8-(2-methyl-4,5-diphenylimidazol-1-yl)octan-3-yl]carbamate.
| Compound Name | (2-fluorophenyl) N-[2-methyl-8-(2-methyl-4,5-diphenylimidazol-1-yl)octan-3-yl]carbamate |
|---|---|
| PubChem CID | 10301312 |
| Molecular Formula | C32H36FN3O2 |
| Molecular Weight | 513.66 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | (2-fluorophenyl) N-[2-methyl-8-(2-methyl-4,5-diphenylimidazol-1-yl)octan-3-yl]carbamate |
| SMILES | Cc1nc(-c2ccccc2)c(-c2ccccc2)n1CCCCCC(NC(=O)Oc1ccccc1F)C(C)C |
| InChI | InChI=1S/C32H36FN3O2/c1-23(2)28(35-32(37)38-29-21-13-12-19-27(29)33)20-11-6-14-22-36-24(3)34-30(25-15-7-4-8-16-25)31(36)26-17-9-5-10-18-26/h4-5,7-10,12-13,15-19,21,23,28H,6,11,14,20,22H2,1-3H3,(H,35,37) |
| InChIKey | HMJCRVRGZFQOMD-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.66 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|