methyl 4-[methyl-[2-(1-methylpyrazol-4-yl)ethyl]amino]butanoate

C12H21N3O2 — CID 103013993

IUPACmethyl 4-[methyl-[2-(1-methylpyrazol-4-yl)ethyl]amino]butanoate
SMILESCOC(=O)CCCN(C)CCc1cnn(C)c1
InChIInChI=1S/C12H21N3O2/c1-14(7-4-5-12(16)17-3)8-6-11-9-13-15(2)10-11/h9-10H,4-8H2,1-3H3
InChIKeyGPLTZKJMYAEOQG-UHFFFAOYSA-N
MW239.32 g/mol
LogP0.85
Rot. Bonds7

About methyl 4-[methyl-[2-(1-methylpyrazol-4-yl)ethyl]amino]butanoate

methyl 4-[methyl-[2-(1-methylpyrazol-4-yl)ethyl]amino]butanoate (PubChem CID 103013993) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is methyl 4-[methyl-[2-(1-methylpyrazol-4-yl)ethyl]amino]butanoate.

Molecular Properties

Compound Namemethyl 4-[methyl-[2-(1-methylpyrazol-4-yl)ethyl]amino]butanoate
PubChem CID103013993
Molecular FormulaC12H21N3O2
Molecular Weight239.32 g/mol
Exact Mass239.16
IUPAC Namemethyl 4-[methyl-[2-(1-methylpyrazol-4-yl)ethyl]amino]butanoate
SMILESCOC(=O)CCCN(C)CCc1cnn(C)c1
InChIInChI=1S/C12H21N3O2/c1-14(7-4-5-12(16)17-3)8-6-11-9-13-15(2)10-11/h9-10H,4-8H2,1-3H3
InChIKeyGPLTZKJMYAEOQG-UHFFFAOYSA-N
XLogP0.85
TPSA47.36 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.32
LogP ≤ 50.85
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 4-[methyl-[2-(1-methylpyrazol-4-yl)ethyl]amino]butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[methyl-[2-(1-methylpyrazol-4-yl)ethyl]amino]butanoate?
The IUPAC name of methyl 4-[methyl-[2-(1-methylpyrazol-4-yl)ethyl]amino]butanoate (CID 103013993) is methyl 4-[methyl-[2-(1-methylpyrazol-4-yl)ethyl]amino]butanoate.
What is the SMILES notation for methyl 4-[methyl-[2-(1-methylpyrazol-4-yl)ethyl]amino]butanoate?
The canonical SMILES for methyl 4-[methyl-[2-(1-methylpyrazol-4-yl)ethyl]amino]butanoate is COC(=O)CCCN(C)CCc1cnn(C)c1.
What is the InChIKey of methyl 4-[methyl-[2-(1-methylpyrazol-4-yl)ethyl]amino]butanoate?
The InChIKey is GPLTZKJMYAEOQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O2/c1-14(7-4-5-12(16)17-3)8-6-11-9-13-15(2)10-11/h9-10H,4-8H2,1-3H3.
What are the key properties of methyl 4-[methyl-[2-(1-methylpyrazol-4-yl)ethyl]amino]butanoate?
methyl 4-[methyl-[2-(1-methylpyrazol-4-yl)ethyl]amino]butanoate has a molecular weight of 239.32 g/mol, XLogP of 0.85, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[methyl-[2-(1-methylpyrazol-4-yl)ethyl]amino]butanoate is sourced from PubChem (CID 103013993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).