C18H27N3 — CID 103014370
N-ethyl-2-[(3-methylphenyl)methyl]-4-(2-methylpyrazol-3-yl)butan-1-amine (PubChem CID 103014370) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is N-ethyl-2-[(3-methylphenyl)methyl]-4-(2-methylpyrazol-3-yl)butan-1-amine.
| Compound Name | N-ethyl-2-[(3-methylphenyl)methyl]-4-(2-methylpyrazol-3-yl)butan-1-amine |
|---|---|
| PubChem CID | 103014370 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | N-ethyl-2-[(3-methylphenyl)methyl]-4-(2-methylpyrazol-3-yl)butan-1-amine |
| SMILES | CCNCC(CCc1ccnn1C)Cc1cccc(C)c1 |
| InChI | InChI=1S/C18H27N3/c1-4-19-14-17(8-9-18-10-11-20-21(18)3)13-16-7-5-6-15(2)12-16/h5-7,10-12,17,19H,4,8-9,13-14H2,1-3H3 |
| InChIKey | UGZVXFMGFFTJKY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |