C10H13N5S — CID 103015046
1-[2-(1-methylpyrazol-4-yl)ethyl]imidazole-2-carbothioamide (PubChem CID 103015046) has the molecular formula C10H13N5S and a molecular weight of 235.32 g/mol. Its IUPAC name is 1-[2-(1-methylpyrazol-4-yl)ethyl]imidazole-2-carbothioamide.
| Compound Name | 1-[2-(1-methylpyrazol-4-yl)ethyl]imidazole-2-carbothioamide |
|---|---|
| PubChem CID | 103015046 |
| Molecular Formula | C10H13N5S |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 1-[2-(1-methylpyrazol-4-yl)ethyl]imidazole-2-carbothioamide |
| SMILES | Cn1cc(CCn2ccnc2C(N)=S)cn1 |
| InChI | InChI=1S/C10H13N5S/c1-14-7-8(6-13-14)2-4-15-5-3-12-10(15)9(11)16/h3,5-7H,2,4H2,1H3,(H2,11,16) |
| InChIKey | HBHMNXZIZOLWPI-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|