C24H27F2N5O4S — CID 10301578
4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]-N-[3-[bis(2-hydroxyethyl)amino]propyl]benzamide (PubChem CID 10301578) has the molecular formula C24H27F2N5O4S and a molecular weight of 519.57 g/mol. Its IUPAC name is 4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]-N-[3-[bis(2-hydroxyethyl)amino]propyl]benzamide.
| Compound Name | 4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]-N-[3-[bis(2-hydroxyethyl)amino]propyl]benzamide |
|---|---|
| PubChem CID | 10301578 |
| Molecular Formula | C24H27F2N5O4S |
| Molecular Weight | 519.57 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | 4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]-N-[3-[bis(2-hydroxyethyl)amino]propyl]benzamide |
| SMILES | Nc1nc(Nc2ccc(C(=O)NCCCN(CCO)CCO)cc2)sc1C(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C24H27F2N5O4S/c25-17-3-1-4-18(26)19(17)20(34)21-22(27)30-24(36-21)29-16-7-5-15(6-8-16)23(35)28-9-2-10-31(11-13-32)12-14-33/h1,3-8,32-33H,2,9-14,27H2,(H,28,35)(H,29,30) |
| InChIKey | OSHIPWLMGMJFBQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 140.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.57 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|