C13H23BrN2 — CID 103016073
5-(5-bromo-6,6-dimethylheptyl)-1-methylpyrazole (PubChem CID 103016073) has the molecular formula C13H23BrN2 and a molecular weight of 287.24 g/mol. Its IUPAC name is 5-(5-bromo-6,6-dimethylheptyl)-1-methylpyrazole.
| Compound Name | 5-(5-bromo-6,6-dimethylheptyl)-1-methylpyrazole |
|---|---|
| PubChem CID | 103016073 |
| Molecular Formula | C13H23BrN2 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 5-(5-bromo-6,6-dimethylheptyl)-1-methylpyrazole |
| SMILES | Cn1nccc1CCCCC(Br)C(C)(C)C |
| InChI | InChI=1S/C13H23BrN2/c1-13(2,3)12(14)8-6-5-7-11-9-10-15-16(11)4/h9-10,12H,5-8H2,1-4H3 |
| InChIKey | PMDWUAYSTITHGJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|