C17H32N4 — CID 103016484
5-butan-2-yl-1-[2-(2-methylpyrazol-3-yl)ethyl]-2-propan-2-ylpiperazine (PubChem CID 103016484) has the molecular formula C17H32N4 and a molecular weight of 292.47 g/mol. Its IUPAC name is 5-butan-2-yl-1-[2-(2-methylpyrazol-3-yl)ethyl]-2-propan-2-ylpiperazine.
| Compound Name | 5-butan-2-yl-1-[2-(2-methylpyrazol-3-yl)ethyl]-2-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 103016484 |
| Molecular Formula | C17H32N4 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.26 |
| IUPAC Name | 5-butan-2-yl-1-[2-(2-methylpyrazol-3-yl)ethyl]-2-propan-2-ylpiperazine |
| SMILES | CCC(C)C1CN(CCc2ccnn2C)C(C(C)C)CN1 |
| InChI | InChI=1S/C17H32N4/c1-6-14(4)16-12-21(17(11-18-16)13(2)3)10-8-15-7-9-19-20(15)5/h7,9,13-14,16-18H,6,8,10-12H2,1-5H3 |
| InChIKey | UTYWIKKNQSFJRM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |