About 2-butan-2-yl-5,5-diethyl-1-(3-methoxy-3-methylbutyl)piperazine
2-butan-2-yl-5,5-diethyl-1-(3-methoxy-3-methylbutyl)piperazine (PubChem CID 103016623) has the molecular formula C18H38N2O
and a molecular weight of 298.51 g/mol. Its IUPAC name is 2-butan-2-yl-5,5-diethyl-1-(3-methoxy-3-methylbutyl)piperazine.
Molecular Properties
| Compound Name | 2-butan-2-yl-5,5-diethyl-1-(3-methoxy-3-methylbutyl)piperazine |
| PubChem CID | 103016623 |
| Molecular Formula | C18H38N2O |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.30 |
| IUPAC Name | 2-butan-2-yl-5,5-diethyl-1-(3-methoxy-3-methylbutyl)piperazine |
| SMILES | CCC(C)C1CNC(CC)(CC)CN1CCC(C)(C)OC |
| InChI | InChI=1S/C18H38N2O/c1-8-15(4)16-13-19-18(9-2,10-3)14-20(16)12-11-17(5,6)21-7/h15-16,19H,8-14H2,1-7H3 |
| InChIKey | GPENIIDNRKOYRF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-butan-2-yl-5,5-diethyl-1-(3-methoxy-3-methylbutyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yl-5,5-diethyl-1-(3-methoxy-3-methylbutyl)piperazine?
The IUPAC name of 2-butan-2-yl-5,5-diethyl-1-(3-methoxy-3-methylbutyl)piperazine (CID 103016623) is 2-butan-2-yl-5,5-diethyl-1-(3-methoxy-3-methylbutyl)piperazine.
What is the SMILES notation for 2-butan-2-yl-5,5-diethyl-1-(3-methoxy-3-methylbutyl)piperazine?
The canonical SMILES for 2-butan-2-yl-5,5-diethyl-1-(3-methoxy-3-methylbutyl)piperazine is CCC(C)C1CNC(CC)(CC)CN1CCC(C)(C)OC.
What is the InChIKey of 2-butan-2-yl-5,5-diethyl-1-(3-methoxy-3-methylbutyl)piperazine?
The InChIKey is GPENIIDNRKOYRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38N2O/c1-8-15(4)16-13-19-18(9-2,10-3)14-20(16)12-11-17(5,6)21-7/h15-16,19H,8-14H2,1-7H3.
What are the key properties of 2-butan-2-yl-5,5-diethyl-1-(3-methoxy-3-methylbutyl)piperazine?
2-butan-2-yl-5,5-diethyl-1-(3-methoxy-3-methylbutyl)piperazine has a molecular weight of 298.51 g/mol, XLogP of 3.68, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yl-5,5-diethyl-1-(3-methoxy-3-methylbutyl)piperazine is sourced from PubChem (CID 103016623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).