C15H18BrClN2 — CID 103018312
4-[3-[(3-bromophenyl)methyl]-4-chlorobutyl]-1-methylpyrazole (PubChem CID 103018312) has the molecular formula C15H18BrClN2 and a molecular weight of 341.68 g/mol. Its IUPAC name is 4-[3-[(3-bromophenyl)methyl]-4-chlorobutyl]-1-methylpyrazole.
| Compound Name | 4-[3-[(3-bromophenyl)methyl]-4-chlorobutyl]-1-methylpyrazole |
|---|---|
| PubChem CID | 103018312 |
| Molecular Formula | C15H18BrClN2 |
| Molecular Weight | 341.68 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 4-[3-[(3-bromophenyl)methyl]-4-chlorobutyl]-1-methylpyrazole |
| SMILES | Cn1cc(CCC(CCl)Cc2cccc(Br)c2)cn1 |
| InChI | InChI=1S/C15H18BrClN2/c1-19-11-14(10-18-19)6-5-13(9-17)7-12-3-2-4-15(16)8-12/h2-4,8,10-11,13H,5-7,9H2,1H3 |
| InChIKey | MZOBGJGWVULVQE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.68 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|