C15H17BrCl2N2 — CID 103018999
5-[3-(4-bromophenyl)-4-chloro-3-(chloromethyl)butyl]-1-methylpyrazole (PubChem CID 103018999) has the molecular formula C15H17BrCl2N2 and a molecular weight of 376.13 g/mol. Its IUPAC name is 5-[3-(4-bromophenyl)-4-chloro-3-(chloromethyl)butyl]-1-methylpyrazole.
| Compound Name | 5-[3-(4-bromophenyl)-4-chloro-3-(chloromethyl)butyl]-1-methylpyrazole |
|---|---|
| PubChem CID | 103018999 |
| Molecular Formula | C15H17BrCl2N2 |
| Molecular Weight | 376.13 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | 5-[3-(4-bromophenyl)-4-chloro-3-(chloromethyl)butyl]-1-methylpyrazole |
| SMILES | Cn1nccc1CCC(CCl)(CCl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H17BrCl2N2/c1-20-14(7-9-19-20)6-8-15(10-17,11-18)12-2-4-13(16)5-3-12/h2-5,7,9H,6,8,10-11H2,1H3 |
| InChIKey | OFTHSTGPPXUXDN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.13 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|