C15H18FN3 — CID 103019187
5-[2-[3-(4-fluorophenyl)azetidin-3-yl]ethyl]-1-methylpyrazole (PubChem CID 103019187) has the molecular formula C15H18FN3 and a molecular weight of 259.33 g/mol. Its IUPAC name is 5-[2-[3-(4-fluorophenyl)azetidin-3-yl]ethyl]-1-methylpyrazole.
| Compound Name | 5-[2-[3-(4-fluorophenyl)azetidin-3-yl]ethyl]-1-methylpyrazole |
|---|---|
| PubChem CID | 103019187 |
| Molecular Formula | C15H18FN3 |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 5-[2-[3-(4-fluorophenyl)azetidin-3-yl]ethyl]-1-methylpyrazole |
| SMILES | Cn1nccc1CCC1(c2ccc(F)cc2)CNC1 |
| InChI | InChI=1S/C15H18FN3/c1-19-14(7-9-18-19)6-8-15(10-17-11-15)12-2-4-13(16)5-3-12/h2-5,7,9,17H,6,8,10-11H2,1H3 |
| InChIKey | XLZUVILIHFGABC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |