About N-(2-cyanoethyl)-3-methoxy-N,3-dimethylbutanamide
N-(2-cyanoethyl)-3-methoxy-N,3-dimethylbutanamide (PubChem CID 103020085) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is N-(2-cyanoethyl)-3-methoxy-N,3-dimethylbutanamide.
Molecular Properties
| Compound Name | N-(2-cyanoethyl)-3-methoxy-N,3-dimethylbutanamide |
| PubChem CID | 103020085 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | N-(2-cyanoethyl)-3-methoxy-N,3-dimethylbutanamide |
| SMILES | COC(C)(C)CC(=O)N(C)CCC#N |
| InChI | InChI=1S/C10H18N2O2/c1-10(2,14-4)8-9(13)12(3)7-5-6-11/h5,7-8H2,1-4H3 |
| InChIKey | ZHWACXJCTUQBJS-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-cyanoethyl)-3-methoxy-N,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyanoethyl)-3-methoxy-N,3-dimethylbutanamide?
The IUPAC name of N-(2-cyanoethyl)-3-methoxy-N,3-dimethylbutanamide (CID 103020085) is N-(2-cyanoethyl)-3-methoxy-N,3-dimethylbutanamide.
What is the SMILES notation for N-(2-cyanoethyl)-3-methoxy-N,3-dimethylbutanamide?
The canonical SMILES for N-(2-cyanoethyl)-3-methoxy-N,3-dimethylbutanamide is COC(C)(C)CC(=O)N(C)CCC#N.
What is the InChIKey of N-(2-cyanoethyl)-3-methoxy-N,3-dimethylbutanamide?
The InChIKey is ZHWACXJCTUQBJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O2/c1-10(2,14-4)8-9(13)12(3)7-5-6-11/h5,7-8H2,1-4H3.
What are the key properties of N-(2-cyanoethyl)-3-methoxy-N,3-dimethylbutanamide?
N-(2-cyanoethyl)-3-methoxy-N,3-dimethylbutanamide has a molecular weight of 198.27 g/mol, XLogP of 1.17, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyanoethyl)-3-methoxy-N,3-dimethylbutanamide is sourced from PubChem (CID 103020085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).