C9H17N3OS — CID 103020461
1-[2-(2-methylpyrazol-3-yl)ethylsulfinyl]propan-2-amine (PubChem CID 103020461) has the molecular formula C9H17N3OS and a molecular weight of 215.32 g/mol. Its IUPAC name is 1-[2-(2-methylpyrazol-3-yl)ethylsulfinyl]propan-2-amine.
| Compound Name | 1-[2-(2-methylpyrazol-3-yl)ethylsulfinyl]propan-2-amine |
|---|---|
| PubChem CID | 103020461 |
| Molecular Formula | C9H17N3OS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 1-[2-(2-methylpyrazol-3-yl)ethylsulfinyl]propan-2-amine |
| SMILES | CC(N)CS(=O)CCc1ccnn1C |
| InChI | InChI=1S/C9H17N3OS/c1-8(10)7-14(13)6-4-9-3-5-11-12(9)2/h3,5,8H,4,6-7,10H2,1-2H3 |
| InChIKey | ULXGPLGGTAURJF-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |