C32H40N2O5 — CID 10302094
[(2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-oxo-1-(pyridin-2-ylmethyl)pyridine-3-carboxylate (PubChem CID 10302094) has the molecular formula C32H40N2O5 and a molecular weight of 532.68 g/mol. Its IUPAC name is [(2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-oxo-1-(pyridin-2-ylmethyl)pyridine-3-carboxylate.
| Compound Name | [(2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-oxo-1-(pyridin-2-ylmethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 10302094 |
| Molecular Formula | C32H40N2O5 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | [(2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-oxo-1-(pyridin-2-ylmethyl)pyridine-3-carboxylate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)c2cccn(Cc3ccccn3)c2=O)[C@@]2(C)C3C(=O)CCC3(CC[C@H]2C)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C32H40N2O5/c1-6-30(4)18-25(31(5)20(2)12-14-32(21(3)27(30)36)15-13-24(35)26(31)32)39-29(38)23-11-9-17-34(28(23)37)19-22-10-7-8-16-33-22/h6-11,16-17,20-21,25-27,36H,1,12-15,18-19H2,2-5H3/t20-,21+,25-,26?,27+,30-,31+,32?/m1/s1 |
| InChIKey | ZPCCONIFQCMJHC-CAJZWKQOSA-N |
| XLogP | 4.81 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|