About N-(3-amino-2,2-difluoropropyl)-2-methoxy-2-methylpropanamide
N-(3-amino-2,2-difluoropropyl)-2-methoxy-2-methylpropanamide (PubChem CID 103021674) has the molecular formula C8H16F2N2O2
and a molecular weight of 210.22 g/mol. Its IUPAC name is N-(3-amino-2,2-difluoropropyl)-2-methoxy-2-methylpropanamide.
Molecular Properties
| Compound Name | N-(3-amino-2,2-difluoropropyl)-2-methoxy-2-methylpropanamide |
| PubChem CID | 103021674 |
| Molecular Formula | C8H16F2N2O2 |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | N-(3-amino-2,2-difluoropropyl)-2-methoxy-2-methylpropanamide |
| SMILES | COC(C)(C)C(=O)NCC(F)(F)CN |
| InChI | InChI=1S/C8H16F2N2O2/c1-7(2,14-3)6(13)12-5-8(9,10)4-11/h4-5,11H2,1-3H3,(H,12,13) |
| InChIKey | IUKPNVSOHSIKIH-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-amino-2,2-difluoropropyl)-2-methoxy-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-amino-2,2-difluoropropyl)-2-methoxy-2-methylpropanamide?
The IUPAC name of N-(3-amino-2,2-difluoropropyl)-2-methoxy-2-methylpropanamide (CID 103021674) is N-(3-amino-2,2-difluoropropyl)-2-methoxy-2-methylpropanamide.
What is the SMILES notation for N-(3-amino-2,2-difluoropropyl)-2-methoxy-2-methylpropanamide?
The canonical SMILES for N-(3-amino-2,2-difluoropropyl)-2-methoxy-2-methylpropanamide is COC(C)(C)C(=O)NCC(F)(F)CN.
What is the InChIKey of N-(3-amino-2,2-difluoropropyl)-2-methoxy-2-methylpropanamide?
The InChIKey is IUKPNVSOHSIKIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F2N2O2/c1-7(2,14-3)6(13)12-5-8(9,10)4-11/h4-5,11H2,1-3H3,(H,12,13).
What are the key properties of N-(3-amino-2,2-difluoropropyl)-2-methoxy-2-methylpropanamide?
N-(3-amino-2,2-difluoropropyl)-2-methoxy-2-methylpropanamide has a molecular weight of 210.22 g/mol, XLogP of 0.12, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-amino-2,2-difluoropropyl)-2-methoxy-2-methylpropanamide is sourced from PubChem (CID 103021674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).