C13H25NO4 — CID 103021720
methyl 6-[(3-methoxy-3-methylbutanoyl)amino]hexanoate (PubChem CID 103021720) has the molecular formula C13H25NO4 and a molecular weight of 259.35 g/mol. Its IUPAC name is methyl 6-[(3-methoxy-3-methylbutanoyl)amino]hexanoate.
| Compound Name | methyl 6-[(3-methoxy-3-methylbutanoyl)amino]hexanoate |
|---|---|
| PubChem CID | 103021720 |
| Molecular Formula | C13H25NO4 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | methyl 6-[(3-methoxy-3-methylbutanoyl)amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)CC(C)(C)OC |
| InChI | InChI=1S/C13H25NO4/c1-13(2,18-4)10-11(15)14-9-7-5-6-8-12(16)17-3/h5-10H2,1-4H3,(H,14,15) |
| InChIKey | KLHVLZMHKMPJGM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|