C13H22FN3 — CID 103023172
3-[2-fluoro-4-(1-methylpyrazol-4-yl)butan-2-yl]piperidine (PubChem CID 103023172) has the molecular formula C13H22FN3 and a molecular weight of 239.34 g/mol. Its IUPAC name is 3-[2-fluoro-4-(1-methylpyrazol-4-yl)butan-2-yl]piperidine.
| Compound Name | 3-[2-fluoro-4-(1-methylpyrazol-4-yl)butan-2-yl]piperidine |
|---|---|
| PubChem CID | 103023172 |
| Molecular Formula | C13H22FN3 |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.18 |
| IUPAC Name | 3-[2-fluoro-4-(1-methylpyrazol-4-yl)butan-2-yl]piperidine |
| SMILES | Cn1cc(CCC(C)(F)C2CCCNC2)cn1 |
| InChI | InChI=1S/C13H22FN3/c1-13(14,12-4-3-7-15-9-12)6-5-11-8-16-17(2)10-11/h8,10,12,15H,3-7,9H2,1-2H3 |
| InChIKey | OCNJPKJUSGDREL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |