C14H24FN3 — CID 103023215
2-[2-fluoro-2-methyl-4-(2-methylpyrazol-3-yl)butyl]piperidine (PubChem CID 103023215) has the molecular formula C14H24FN3 and a molecular weight of 253.36 g/mol. Its IUPAC name is 2-[2-fluoro-2-methyl-4-(2-methylpyrazol-3-yl)butyl]piperidine.
| Compound Name | 2-[2-fluoro-2-methyl-4-(2-methylpyrazol-3-yl)butyl]piperidine |
|---|---|
| PubChem CID | 103023215 |
| Molecular Formula | C14H24FN3 |
| Molecular Weight | 253.36 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 2-[2-fluoro-2-methyl-4-(2-methylpyrazol-3-yl)butyl]piperidine |
| SMILES | Cn1nccc1CCC(C)(F)CC1CCCCN1 |
| InChI | InChI=1S/C14H24FN3/c1-14(15,11-12-5-3-4-9-16-12)8-6-13-7-10-17-18(13)2/h7,10,12,16H,3-6,8-9,11H2,1-2H3 |
| InChIKey | AJYDXXBSFUJSIM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |