C30H41N3O6 — CID 10302376
N-heptyl-2-[(3S)-4-methyl-2,5-dioxo-3-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazin-1-yl]acetamide (PubChem CID 10302376) has the molecular formula C30H41N3O6 and a molecular weight of 539.67 g/mol. Its IUPAC name is N-heptyl-2-[(3S)-4-methyl-2,5-dioxo-3-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazin-1-yl]acetamide.
| Compound Name | N-heptyl-2-[(3S)-4-methyl-2,5-dioxo-3-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 10302376 |
| Molecular Formula | C30H41N3O6 |
| Molecular Weight | 539.67 g/mol |
| Exact Mass | 539.30 |
| IUPAC Name | N-heptyl-2-[(3S)-4-methyl-2,5-dioxo-3-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazin-1-yl]acetamide |
| SMILES | CCCCCCCNC(=O)CN1CC(=O)N(C)[C@@H](Cc2ccc(-c3cc(OC)c(OC)c(OC)c3)cc2)C1=O |
| InChI | InChI=1S/C30H41N3O6/c1-6-7-8-9-10-15-31-27(34)19-33-20-28(35)32(2)24(30(33)36)16-21-11-13-22(14-12-21)23-17-25(37-3)29(39-5)26(18-23)38-4/h11-14,17-18,24H,6-10,15-16,19-20H2,1-5H3,(H,31,34)/t24-/m0/s1 |
| InChIKey | QWVHTYFXAUZJFB-DEOSSOPVSA-N |
| XLogP | 3.68 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.67 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|