About (7-methoxy-3,3,7-trimethyloctan-4-yl)hydrazine
(7-methoxy-3,3,7-trimethyloctan-4-yl)hydrazine (PubChem CID 103026404) has the molecular formula C12H28N2O
and a molecular weight of 216.37 g/mol. Its IUPAC name is (7-methoxy-3,3,7-trimethyloctan-4-yl)hydrazine.
Molecular Properties
| Compound Name | (7-methoxy-3,3,7-trimethyloctan-4-yl)hydrazine |
| PubChem CID | 103026404 |
| Molecular Formula | C12H28N2O |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.22 |
| IUPAC Name | (7-methoxy-3,3,7-trimethyloctan-4-yl)hydrazine |
| SMILES | CCC(C)(C)C(CCC(C)(C)OC)NN |
| InChI | InChI=1S/C12H28N2O/c1-7-11(2,3)10(14-13)8-9-12(4,5)15-6/h10,14H,7-9,13H2,1-6H3 |
| InChIKey | VIELQHCJADVQMA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (7-methoxy-3,3,7-trimethyloctan-4-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-methoxy-3,3,7-trimethyloctan-4-yl)hydrazine?
The IUPAC name of (7-methoxy-3,3,7-trimethyloctan-4-yl)hydrazine (CID 103026404) is (7-methoxy-3,3,7-trimethyloctan-4-yl)hydrazine.
What is the SMILES notation for (7-methoxy-3,3,7-trimethyloctan-4-yl)hydrazine?
The canonical SMILES for (7-methoxy-3,3,7-trimethyloctan-4-yl)hydrazine is CCC(C)(C)C(CCC(C)(C)OC)NN.
What is the InChIKey of (7-methoxy-3,3,7-trimethyloctan-4-yl)hydrazine?
The InChIKey is VIELQHCJADVQMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28N2O/c1-7-11(2,3)10(14-13)8-9-12(4,5)15-6/h10,14H,7-9,13H2,1-6H3.
What are the key properties of (7-methoxy-3,3,7-trimethyloctan-4-yl)hydrazine?
(7-methoxy-3,3,7-trimethyloctan-4-yl)hydrazine has a molecular weight of 216.37 g/mol, XLogP of 2.46, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7-methoxy-3,3,7-trimethyloctan-4-yl)hydrazine is sourced from PubChem (CID 103026404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).