About [4-methoxy-4-methyl-1-(2,4,5-trimethyloxolan-3-yl)pentyl]hydrazine
[4-methoxy-4-methyl-1-(2,4,5-trimethyloxolan-3-yl)pentyl]hydrazine (PubChem CID 103026412) has the molecular formula C14H30N2O2
and a molecular weight of 258.41 g/mol. Its IUPAC name is [4-methoxy-4-methyl-1-(2,4,5-trimethyloxolan-3-yl)pentyl]hydrazine.
Molecular Properties
| Compound Name | [4-methoxy-4-methyl-1-(2,4,5-trimethyloxolan-3-yl)pentyl]hydrazine |
| PubChem CID | 103026412 |
| Molecular Formula | C14H30N2O2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | [4-methoxy-4-methyl-1-(2,4,5-trimethyloxolan-3-yl)pentyl]hydrazine |
| SMILES | COC(C)(C)CCC(NN)C1C(C)OC(C)C1C |
| InChI | InChI=1S/C14H30N2O2/c1-9-10(2)18-11(3)13(9)12(16-15)7-8-14(4,5)17-6/h9-13,16H,7-8,15H2,1-6H3 |
| InChIKey | PKFKRBGZPFXQHJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-methoxy-4-methyl-1-(2,4,5-trimethyloxolan-3-yl)pentyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-methoxy-4-methyl-1-(2,4,5-trimethyloxolan-3-yl)pentyl]hydrazine?
The IUPAC name of [4-methoxy-4-methyl-1-(2,4,5-trimethyloxolan-3-yl)pentyl]hydrazine (CID 103026412) is [4-methoxy-4-methyl-1-(2,4,5-trimethyloxolan-3-yl)pentyl]hydrazine.
What is the SMILES notation for [4-methoxy-4-methyl-1-(2,4,5-trimethyloxolan-3-yl)pentyl]hydrazine?
The canonical SMILES for [4-methoxy-4-methyl-1-(2,4,5-trimethyloxolan-3-yl)pentyl]hydrazine is COC(C)(C)CCC(NN)C1C(C)OC(C)C1C.
What is the InChIKey of [4-methoxy-4-methyl-1-(2,4,5-trimethyloxolan-3-yl)pentyl]hydrazine?
The InChIKey is PKFKRBGZPFXQHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N2O2/c1-9-10(2)18-11(3)13(9)12(16-15)7-8-14(4,5)17-6/h9-13,16H,7-8,15H2,1-6H3.
What are the key properties of [4-methoxy-4-methyl-1-(2,4,5-trimethyloxolan-3-yl)pentyl]hydrazine?
[4-methoxy-4-methyl-1-(2,4,5-trimethyloxolan-3-yl)pentyl]hydrazine has a molecular weight of 258.41 g/mol, XLogP of 2.08, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-methoxy-4-methyl-1-(2,4,5-trimethyloxolan-3-yl)pentyl]hydrazine is sourced from PubChem (CID 103026412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).