C14H32N2O — CID 103026499
(8-methoxy-2,2,3,8-tetramethylnonan-5-yl)hydrazine (PubChem CID 103026499) has the molecular formula C14H32N2O and a molecular weight of 244.42 g/mol. Its IUPAC name is (8-methoxy-2,2,3,8-tetramethylnonan-5-yl)hydrazine.
| Compound Name | (8-methoxy-2,2,3,8-tetramethylnonan-5-yl)hydrazine |
|---|---|
| PubChem CID | 103026499 |
| Molecular Formula | C14H32N2O |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.25 |
| IUPAC Name | (8-methoxy-2,2,3,8-tetramethylnonan-5-yl)hydrazine |
| SMILES | COC(C)(C)CCC(CC(C)C(C)(C)C)NN |
| InChI | InChI=1S/C14H32N2O/c1-11(13(2,3)4)10-12(16-15)8-9-14(5,6)17-7/h11-12,16H,8-10,15H2,1-7H3 |
| InChIKey | VKDSGRUYJYODDQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|