C16H35N3O — CID 103026906
1-(1-hydrazinyl-4-methoxy-4-methylpentyl)-N,N,3-trimethylcyclohexan-1-amine (PubChem CID 103026906) has the molecular formula C16H35N3O and a molecular weight of 285.48 g/mol. Its IUPAC name is 1-(1-hydrazinyl-4-methoxy-4-methylpentyl)-N,N,3-trimethylcyclohexan-1-amine.
| Compound Name | 1-(1-hydrazinyl-4-methoxy-4-methylpentyl)-N,N,3-trimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 103026906 |
| Molecular Formula | C16H35N3O |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.28 |
| IUPAC Name | 1-(1-hydrazinyl-4-methoxy-4-methylpentyl)-N,N,3-trimethylcyclohexan-1-amine |
| SMILES | COC(C)(C)CCC(NN)C1(N(C)C)CCCC(C)C1 |
| InChI | InChI=1S/C16H35N3O/c1-13-8-7-10-16(12-13,19(4)5)14(18-17)9-11-15(2,3)20-6/h13-14,18H,7-12,17H2,1-6H3 |
| InChIKey | RBDVFHVTENTJTG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|