C8H14F2N4 — CID 103027033
[1,1-difluoro-4-(1-methylpyrazol-4-yl)butan-2-yl]hydrazine (PubChem CID 103027033) has the molecular formula C8H14F2N4 and a molecular weight of 204.22 g/mol. Its IUPAC name is [1,1-difluoro-4-(1-methylpyrazol-4-yl)butan-2-yl]hydrazine.
| Compound Name | [1,1-difluoro-4-(1-methylpyrazol-4-yl)butan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103027033 |
| Molecular Formula | C8H14F2N4 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | [1,1-difluoro-4-(1-methylpyrazol-4-yl)butan-2-yl]hydrazine |
| SMILES | Cn1cc(CCC(NN)C(F)F)cn1 |
| InChI | InChI=1S/C8H14F2N4/c1-14-5-6(4-12-14)2-3-7(13-11)8(9)10/h4-5,7-8,13H,2-3,11H2,1H3 |
| InChIKey | CQCLLICTUDCKCJ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|