About (1-chloro-1,1-difluoro-5-methoxy-5-methylhexan-2-yl)hydrazine
(1-chloro-1,1-difluoro-5-methoxy-5-methylhexan-2-yl)hydrazine (PubChem CID 103027038) has the molecular formula C8H17ClF2N2O
and a molecular weight of 230.69 g/mol. Its IUPAC name is (1-chloro-1,1-difluoro-5-methoxy-5-methylhexan-2-yl)hydrazine.
Molecular Properties
| Compound Name | (1-chloro-1,1-difluoro-5-methoxy-5-methylhexan-2-yl)hydrazine |
| PubChem CID | 103027038 |
| Molecular Formula | C8H17ClF2N2O |
| Molecular Weight | 230.69 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | (1-chloro-1,1-difluoro-5-methoxy-5-methylhexan-2-yl)hydrazine |
| SMILES | COC(C)(C)CCC(NN)C(F)(F)Cl |
| InChI | InChI=1S/C8H17ClF2N2O/c1-7(2,14-3)5-4-6(13-12)8(9,10)11/h6,13H,4-5,12H2,1-3H3 |
| InChIKey | RFSPQWCYIPNXRH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.69 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1-chloro-1,1-difluoro-5-methoxy-5-methylhexan-2-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-chloro-1,1-difluoro-5-methoxy-5-methylhexan-2-yl)hydrazine?
The IUPAC name of (1-chloro-1,1-difluoro-5-methoxy-5-methylhexan-2-yl)hydrazine (CID 103027038) is (1-chloro-1,1-difluoro-5-methoxy-5-methylhexan-2-yl)hydrazine.
What is the SMILES notation for (1-chloro-1,1-difluoro-5-methoxy-5-methylhexan-2-yl)hydrazine?
The canonical SMILES for (1-chloro-1,1-difluoro-5-methoxy-5-methylhexan-2-yl)hydrazine is COC(C)(C)CCC(NN)C(F)(F)Cl.
What is the InChIKey of (1-chloro-1,1-difluoro-5-methoxy-5-methylhexan-2-yl)hydrazine?
The InChIKey is RFSPQWCYIPNXRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17ClF2N2O/c1-7(2,14-3)5-4-6(13-12)8(9,10)11/h6,13H,4-5,12H2,1-3H3.
What are the key properties of (1-chloro-1,1-difluoro-5-methoxy-5-methylhexan-2-yl)hydrazine?
(1-chloro-1,1-difluoro-5-methoxy-5-methylhexan-2-yl)hydrazine has a molecular weight of 230.69 g/mol, XLogP of 1.86, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-chloro-1,1-difluoro-5-methoxy-5-methylhexan-2-yl)hydrazine is sourced from PubChem (CID 103027038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).